(2S)-3-phenyl-2-[(phenylcarbonyl)amino]propanoate
Benzoyl-DL-phenylalanine
CAS: 2901-76-0
Molecular Formula: C16H15NO3
(2S)-3-phenyl-2-[(phenylcarbonyl)amino]propanoate - Names and Identifiers
| Name | Benzoyl-DL-phenylalanine |
| Synonyms | NSC 118532 55405-93-1 T0514-5203 NCGC00142256-01 SDCCGMLS-0091886.P001 Benzoyl-DL-phenylalanine N-benzoyl-D-phenylalanine D-phenylalanine, N-benzoyl- (2R)-3-phenyl-2-[(phenylcarbonyl)amino]propanoate (2S)-3-phenyl-2-[(phenylcarbonyl)amino]propanoate (2S)-3-phenyl-2-(phenylcarbonylamino)propanoic acid |
| CAS | 2901-76-0 |
| InChI | InChI=1/C16H15NO3/c18-15(13-9-5-2-6-10-13)17-14(16(19)20)11-12-7-3-1-4-8-12/h1-10,14H,11H2,(H,17,18)(H,19,20)/t14-/m1/s1 |
(2S)-3-phenyl-2-[(phenylcarbonyl)amino]propanoate - Physico-chemical Properties
| Molecular Formula | C16H15NO3 |
| Molar Mass | 269.3 |
| Density | 1.1347 (rough estimate) |
| Melting Point | 187°C |
| Boling Point | 412.44°C (rough estimate) |
| Flash Point | 275.5°C |
| Water Solubility | 0.85g/L(25.1 ºC) |
| Solubility | almost transparency in Methanol |
| Vapor Presure | 3.8E-12mmHg at 25°C |
| Appearance | powder to crystal |
| Color | White to Almost white |
| pKa | 3.80±0.10(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.6000 (estimate) |
| MDL | MFCD00037252 |
(2S)-3-phenyl-2-[(phenylcarbonyl)amino]propanoate - Risk and Safety
| Safety Description | S22 - Do not breathe dust. S24/25 - Avoid contact with skin and eyes. |
| Hazard Class | IRRITANT |
(2S)-3-phenyl-2-[(phenylcarbonyl)amino]propanoate - Introduction
Benzoyl-DL-phenylalanine is an organic compound with benzoyl and DL-phenylalanine groups in its chemical structure.
Its properties are as follows:
1. Appearance: white crystal or powder;
2. Solubility: soluble in polar solvents such as water, alcohol and Ketone solvents, insoluble in non-polar solvents such as petroleum ether;
3. Melting Point: about 175-180 degrees Celsius.
Benzoyl-DL-phenylalanine are mainly used as pharmaceutical raw materials and synthetic intermediates in the pharmaceutical field. Specific uses are as follows:
1. Medical applications: for the synthesis of biologically active compounds, such as anti-inflammatory, antibacterial, antiviral drugs;
2. Cosmetic application: used as an additive for skin care products, creams, etc. in cosmetics.
In terms of preparation, a common synthesis method is to generate Benzoyl-DL-phenylalanine by reacting benzoyl chloride with DL-phenylalanine. The reaction conditions and the choice of catalyst can be determined according to the specific synthesis scheme.
Regarding safety information, Benzoyl-DL-phenylalanine is generally relatively safe under normal use conditions, the following matters still need to be noted:
1. Avoid direct inhalation or contact with powdered substances to prevent irritation to respiratory tract and skin;
2. Use should wear appropriate personal protective equipment, such as masks, gloves and goggles;
3. Storage should be sealed to avoid contact with oxidants and acidic substances.
Its properties are as follows:
1. Appearance: white crystal or powder;
2. Solubility: soluble in polar solvents such as water, alcohol and Ketone solvents, insoluble in non-polar solvents such as petroleum ether;
3. Melting Point: about 175-180 degrees Celsius.
Benzoyl-DL-phenylalanine are mainly used as pharmaceutical raw materials and synthetic intermediates in the pharmaceutical field. Specific uses are as follows:
1. Medical applications: for the synthesis of biologically active compounds, such as anti-inflammatory, antibacterial, antiviral drugs;
2. Cosmetic application: used as an additive for skin care products, creams, etc. in cosmetics.
In terms of preparation, a common synthesis method is to generate Benzoyl-DL-phenylalanine by reacting benzoyl chloride with DL-phenylalanine. The reaction conditions and the choice of catalyst can be determined according to the specific synthesis scheme.
Regarding safety information, Benzoyl-DL-phenylalanine is generally relatively safe under normal use conditions, the following matters still need to be noted:
1. Avoid direct inhalation or contact with powdered substances to prevent irritation to respiratory tract and skin;
2. Use should wear appropriate personal protective equipment, such as masks, gloves and goggles;
3. Storage should be sealed to avoid contact with oxidants and acidic substances.
Last Update：2024-04-09 21:50:46
![(2S)-3-phenyl-2-[(phenylcarbonyl)amino]propanoate](http://res.chembk.com/assets/str/2d/2/29/2901-76-0.png)
Supplier List
Product Name: Benzoyl-DL-Phenylalanine Visit Supplier Webpage Request for quotation
CAS: 2901-76-0
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 2901-76-0
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: Benzoyl-DL-Phenylalanine Visit Supplier Webpage Request for quotation
CAS: 2901-76-0
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 2901-76-0
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History